Difference between revisions of "CPD-194"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13524 == * common-name: ** all-trans-retinol * molecular-weight: ** 286.456 * inchi-key: ** fpipgxgpppqfeq-ovsjkpmpsa-n * smiles: **...")
(Created page with "Category:metabolite == Metabolite PROTEIN-C-TERMINAL-S-ETC-CYSTEINE == * common-name: ** a [protein] c-terminal s-farnesyl-l-cysteine == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13524 ==
+
== Metabolite PROTEIN-C-TERMINAL-S-ETC-CYSTEINE ==
 
* common-name:
 
* common-name:
** all-trans-retinol
+
** a [protein] c-terminal s-farnesyl-l-cysteine
* molecular-weight:
 
** 286.456
 
* inchi-key:
 
** fpipgxgpppqfeq-ovsjkpmpsa-n
 
* smiles:
 
** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.3.99.23-RXN]]
+
* [[2.1.1.100-RXN]]
* [[RETINOL-DEHYDROGENASE-RXN]]
 
* [[RXN-10841]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.1.64-RXN]]
 
* [[RETINOL-DEHYDROGENASE-RXN]]
 
* [[RXN-10841]]
 
* [[RXN-12575]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-retinol}}
+
{{#set: common-name=a [protein] c-terminal s-farnesyl-l-cysteine}}
{{#set: molecular-weight=286.456}}
 
{{#set: inchi-key=inchikey=fpipgxgpppqfeq-ovsjkpmpsa-n}}
 

Revision as of 15:07, 15 March 2021

Metabolite PROTEIN-C-TERMINAL-S-ETC-CYSTEINE

  • common-name:
    • a [protein] c-terminal s-farnesyl-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein] c-terminal s-farnesyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.