Difference between revisions of "NN-DIMETHYLANILINE-N-OXIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite APS == * common-name: ** adenosine 5'-phosphosulfate * molecular-weight: ** 425.266 * inchi-key: ** irlpacmltupbcl-kqynxxcusa-l * smiles:...") |
(Created page with "Category:metabolite == Metabolite TDP == * common-name: ** dtdp * molecular-weight: ** 399.167 * inchi-key: ** ujlxyodchaelly-xlpzgreqsa-k * smiles: ** cc1(=cn(c(=o)nc(=o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite TDP == |
* common-name: | * common-name: | ||
| − | ** | + | ** dtdp |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 399.167 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ujlxyodchaelly-xlpzgreqsa-k |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])[o-])o2)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DTDPKIN-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DTMPKI-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dtdp}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=399.167}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ujlxyodchaelly-xlpzgreqsa-k}} |
Revision as of 15:07, 15 March 2021
Contents
Metabolite TDP
- common-name:
- dtdp
- molecular-weight:
- 399.167
- inchi-key:
- ujlxyodchaelly-xlpzgreqsa-k
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])[o-])o2))
