Difference between revisions of "Charged-GLY-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-KETOLACTOSE == * common-name: ** 3'-ketolactose * molecular-weight: ** 340.283 * inchi-key: ** hkkhtabthsudbp-gihchdtpsa-n * smiles: **...")
(Created page with "Category:metabolite == Metabolite CPD-1083 == * common-name: ** (e)-2-methylcrotonoyl-coa * molecular-weight: ** 845.604 * inchi-key: ** pmwatmxoqqznbx-dkbzllmosa-j * smil...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-KETOLACTOSE ==
+
== Metabolite CPD-1083 ==
 
* common-name:
 
* common-name:
** 3'-ketolactose
+
** (e)-2-methylcrotonoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 340.283
+
** 845.604
 
* inchi-key:
 
* inchi-key:
** hkkhtabthsudbp-gihchdtpsa-n
+
** pmwatmxoqqznbx-dkbzllmosa-j
 
* smiles:
 
* smiles:
** c(o)c2(oc(oc1(c(co)oc(o)c(o)c(o)1))c(o)c(=o)c(o)2)
+
** cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[KETOLACTOSE-RXN]]
+
* [[2-METHYLACYL-COA-DEHYDROGENASE-RXN]]
 +
* [[RXN-14266]]
 +
* [[TIGLYLCOA-HYDROXY-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2-METHYLACYL-COA-DEHYDROGENASE-RXN]]
 +
* [[RXN-14266]]
 +
* [[TIGLYLCOA-HYDROXY-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3'-ketolactose}}
+
{{#set: common-name=(e)-2-methylcrotonoyl-coa}}
{{#set: molecular-weight=340.283}}
+
{{#set: molecular-weight=845.604}}
{{#set: inchi-key=inchikey=hkkhtabthsudbp-gihchdtpsa-n}}
+
{{#set: inchi-key=inchikey=pmwatmxoqqznbx-dkbzllmosa-j}}

Revision as of 15:07, 15 March 2021

Metabolite CPD-1083

  • common-name:
    • (e)-2-methylcrotonoyl-coa
  • molecular-weight:
    • 845.604
  • inchi-key:
    • pmwatmxoqqznbx-dkbzllmosa-j
  • smiles:
    • cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality