Difference between revisions of "CDPDIACYLGLYCEROL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite EDTA == * common_name: ** edta * smiles: ** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o * inchi_key: ** inchikey=kcxvzyzypll...")
(Created page with "Category:metabolite == Metabolite CPD0-2030 == * common-name: ** glycerophosphoserine * molecular-weight: ** 258.144 * inchi-key: ** zwzwygmenqvnfu-uhnvwzdzsa-m * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite EDTA ==
+
== Metabolite CPD0-2030 ==
* common_name:
+
* common-name:
** edta
+
** glycerophosphoserine
 +
* molecular-weight:
 +
** 258.144
 +
* inchi-key:
 +
** zwzwygmenqvnfu-uhnvwzdzsa-m
 
* smiles:
 
* smiles:
** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o
+
** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o
* inchi_key:
 
** inchikey=kcxvzyzypllwcc-uhfffaoysa-l
 
* molecular_weight:
 
** 290.229   
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ExchangeSeed-EDTA]]
+
* [[RXN-14136]]
* [[TransportSeed-EDTA]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ExchangeSeed-EDTA]]
 
* [[TransportSeed-EDTA]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common_name=edta}}
+
{{#set: common-name=glycerophosphoserine}}
{{#set: inchi_key=inchikey=kcxvzyzypllwcc-uhfffaoysa-l}}
+
{{#set: molecular-weight=258.144}}
{{#set: molecular_weight=290.229    }}
+
{{#set: inchi-key=inchikey=zwzwygmenqvnfu-uhnvwzdzsa-m}}

Revision as of 15:08, 15 March 2021

Metabolite CPD0-2030

  • common-name:
    • glycerophosphoserine
  • molecular-weight:
    • 258.144
  • inchi-key:
    • zwzwygmenqvnfu-uhnvwzdzsa-m
  • smiles:
    • c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality