Difference between revisions of "PROT-CYS"

Revision as of 15:08, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-15666 ==
+== Metabolite FORMYL-THF-GLU-N ==
 * common-name:
-** 2-trans,6-cis-tridecadienoyl-coa
+** a 10-formyltetrahydrofolate
-* molecular-weight:
-** 955.803
-* inchi-key:
-** oosdlbaxvxkfib-gtubxknvsa-j
-* smiles:
-** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 == Reaction(s) known to consume the compound ==
+* [[AICARTRANSFORM-RXN]]
+* [[FORMATETHFLIG-RXN]]
+* [[FORMYLTHFDEFORMYL-RXN]]
+* [[FORMYLTHFGLUSYNTH-RXN]]
+* [[GART-RXN]]
+* [[METHENYLTHFCYCLOHYDRO-RXN]]
+* [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-14771]]
+* [[AICARTRANSFORM-RXN]]
+* [[FORMATETHFLIG-RXN]]
+* [[FORMYLTHFGLUSYNTH-RXN]]
+* [[GART-RXN]]
+* [[METHENYLTHFCYCLOHYDRO-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=2-trans,6-cis-tridecadienoyl-coa}}
+{{#set: common-name=a 10-formyltetrahydrofolate}}
-{{#set: molecular-weight=955.803}}
-{{#set: inchi-key=inchikey=oosdlbaxvxkfib-gtubxknvsa-j}}