Difference between revisions of "Ribonucleoside-Diphosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8268 == * common-name: ** dioleoyl phosphatidate * molecular-weight: ** 698.959 * inchi-key: ** mhuwzntuiifhas-dssvuwshsa-l * smiles:...") |
(Created page with "Category:metabolite == Metabolite 3-METHYLTHIOPROPYL-GLUCOSINOLATE == * common-name: ** glucoiberverin * molecular-weight: ** 406.46 * inchi-key: ** zczcvjvujgulmo-bzvdqrp...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-METHYLTHIOPROPYL-GLUCOSINOLATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** glucoiberverin |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 406.46 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zczcvjvujgulmo-bzvdqrpcsa-m |
* smiles: | * smiles: | ||
| − | ** | + | ** cscccc(=nos(=o)(=o)[o-])sc1(oc(co)c(o)c(o)c(o)1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-2221]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glucoiberverin}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=406.46}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zczcvjvujgulmo-bzvdqrpcsa-m}} |
Revision as of 15:08, 15 March 2021
Contents
Metabolite 3-METHYLTHIOPROPYL-GLUCOSINOLATE
- common-name:
- glucoiberverin
- molecular-weight:
- 406.46
- inchi-key:
- zczcvjvujgulmo-bzvdqrpcsa-m
- smiles:
- cscccc(=nos(=o)(=o)[o-])sc1(oc(co)c(o)c(o)c(o)1)
