Difference between revisions of "FORMYL-THF-GLU-N"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Amino-Acids == * common-name: ** an amino acid == Reaction(s) known to consume the compound == * GAMMA-GLUTAMYLTRANSFERASE-RXN == Rea...")
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-ATP == * common-name: ** 1-(5-phospho-β-d-ribosyl)-atp * molecular-weight: ** 714.24 * inchi-key: ** rknhjbvbfhdxgr-k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Amino-Acids ==
+
== Metabolite PHOSPHORIBOSYL-ATP ==
 
* common-name:
 
* common-name:
** an amino acid
+
** 1-(5-phospho-β-d-ribosyl)-atp
 +
* molecular-weight:
 +
** 714.24
 +
* inchi-key:
 +
** rknhjbvbfhdxgr-keohhstqsa-i
 +
* smiles:
 +
** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
+
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 +
* [[HISTPRATPHYD-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an amino acid}}
+
{{#set: common-name=1-(5-phospho-β-d-ribosyl)-atp}}
 +
{{#set: molecular-weight=714.24}}
 +
{{#set: inchi-key=inchikey=rknhjbvbfhdxgr-keohhstqsa-i}}

Revision as of 15:08, 15 March 2021

Metabolite PHOSPHORIBOSYL-ATP

  • common-name:
    • 1-(5-phospho-β-d-ribosyl)-atp
  • molecular-weight:
    • 714.24
  • inchi-key:
    • rknhjbvbfhdxgr-keohhstqsa-i
  • smiles:
    • c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality