Difference between revisions of "ISOVALERYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11268 == * common-name: ** n1,n12-diacetylspermine * molecular-weight: ** 288.432 * inchi-key: ** npdtudwgjmbvep-uhfffaoysa-p * smile...")
(Created page with "Category:metabolite == Metabolite MtmC-Proteins == * common-name: ** a [co(i) methylamine-specific corrinoid protein] == Reaction(s) known to consume the compound == * R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11268 ==
+
== Metabolite MtmC-Proteins ==
 
* common-name:
 
* common-name:
** n1,n12-diacetylspermine
+
** a [co(i) methylamine-specific corrinoid protein]
* molecular-weight:
 
** 288.432
 
* inchi-key:
 
** npdtudwgjmbvep-uhfffaoysa-p
 
* smiles:
 
** cc(=o)nccc[n+]cccc[n+]cccnc(=o)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10460]]
+
* [[RXN-8098]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8099]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n1,n12-diacetylspermine}}
+
{{#set: common-name=a [co(i) methylamine-specific corrinoid protein]}}
{{#set: molecular-weight=288.432}}
 
{{#set: inchi-key=inchikey=npdtudwgjmbvep-uhfffaoysa-p}}
 

Revision as of 15:08, 15 March 2021

Metabolite MtmC-Proteins

  • common-name:
    • a [co(i) methylamine-specific corrinoid protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [co(i) methylamine-specific corrinoid protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.