Difference between revisions of "CPD1G-1345"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-METHYL-CROTONYL-COA == * common-name: ** 3-methylcrotonyl-coa * molecular-weight: ** 845.604 * inchi-key: ** bxipalatiynhjn-zmhdxicwsa-...")
(Created page with "Category:metabolite == Metabolite Enoylglutaryl-ACP-methyl-esters == * common-name: ** an enoylglutaryl-[acp] methyl ester == Reaction(s) known to consume the compound ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-METHYL-CROTONYL-COA ==
+
== Metabolite Enoylglutaryl-ACP-methyl-esters ==
 
* common-name:
 
* common-name:
** 3-methylcrotonyl-coa
+
** an enoylglutaryl-[acp] methyl ester
* molecular-weight:
 
** 845.604
 
* inchi-key:
 
** bxipalatiynhjn-zmhdxicwsa-j
 
* smiles:
 
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
+
* [[RXN-11478]]
* [[RXN-14264]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11921]]
+
* [[RXN-11477]]
* [[RXN-14264]]
 
* [[RXN0-2301]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methylcrotonyl-coa}}
+
{{#set: common-name=an enoylglutaryl-[acp] methyl ester}}
{{#set: molecular-weight=845.604}}
 
{{#set: inchi-key=inchikey=bxipalatiynhjn-zmhdxicwsa-j}}
 

Revision as of 15:08, 15 March 2021

Metabolite Enoylglutaryl-ACP-methyl-esters

  • common-name:
    • an enoylglutaryl-[acp] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an enoylglutaryl-[acp] methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.