Difference between revisions of "METHYLARSONITE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Oxidized-Flavoproteins == * common-name: ** an [oxidized flavoprotein] == Reaction(s) known to consume the compound == == Reaction(s) kno...") |
(Created page with "Category:metabolite == Metabolite UDP-D-GALACTURONATE == * common-name: ** udp-α-d-galacturonate * molecular-weight: ** 577.265 * inchi-key: ** hdyanyhvcapmjv-gxnrkq...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite UDP-D-GALACTURONATE == |
* common-name: | * common-name: | ||
− | ** | + | ** udp-α-d-galacturonate |
+ | * molecular-weight: | ||
+ | ** 577.265 | ||
+ | * inchi-key: | ||
+ | ** hdyanyhvcapmjv-gxnrkqdosa-k | ||
+ | * smiles: | ||
+ | ** c(op(=o)([o-])op(=o)([o-])oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[UDP-GLUCURONATE-4-EPIMERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[UDP-GLUCURONATE-4-EPIMERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=udp-α-d-galacturonate}} |
+ | {{#set: molecular-weight=577.265}} | ||
+ | {{#set: inchi-key=inchikey=hdyanyhvcapmjv-gxnrkqdosa-k}} |
Revision as of 15:09, 15 March 2021
Contents
Metabolite UDP-D-GALACTURONATE
- common-name:
- udp-α-d-galacturonate
- molecular-weight:
- 577.265
- inchi-key:
- hdyanyhvcapmjv-gxnrkqdosa-k
- smiles:
- c(op(=o)([o-])op(=o)([o-])oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3))