Difference between revisions of "CPD-11495"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3Z-PHYTOCHROMOBILIN == * common-name: ** (3z)-phytochromobilin * molecular-weight: ** 582.655 * inchi-key: ** dkmlmzvdtgoegu-aikfxvfzsa-l...")
(Created page with "Category:metabolite == Metabolite L-DELTA1-PYRROLINE_5-CARBOXYLATE == * common-name: ** (s)-1-pyrroline-5-carboxylate * molecular-weight: ** 112.108 * inchi-key: ** dwaknk...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3Z-PHYTOCHROMOBILIN ==
+
== Metabolite L-DELTA1-PYRROLINE_5-CARBOXYLATE ==
 
* common-name:
 
* common-name:
** (3z)-phytochromobilin
+
** (s)-1-pyrroline-5-carboxylate
 
* molecular-weight:
 
* molecular-weight:
** 582.655
+
** 112.108
 
* inchi-key:
 
* inchi-key:
** dkmlmzvdtgoegu-aikfxvfzsa-l
+
** dwaknkkxgalpnw-bypyzucnsa-m
 
* smiles:
 
* smiles:
** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o)
+
** c1(=nc(cc1)c(=o)[o-])
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PYRROLINECARBDEHYDROG-RXN]]
 +
* [[PYRROLINECARBREDUCT-RXN]]
 +
* [[RXN0-7005]]
 +
* [[SPONTPRO-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.3.7.4-RXN]]
+
* [[RXN-14903]]
 +
* [[RXN0-7008]]
 +
* [[RXN66-542]]
 +
* [[SPONTPRO-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3z)-phytochromobilin}}
+
{{#set: common-name=(s)-1-pyrroline-5-carboxylate}}
{{#set: molecular-weight=582.655}}
+
{{#set: molecular-weight=112.108}}
{{#set: inchi-key=inchikey=dkmlmzvdtgoegu-aikfxvfzsa-l}}
+
{{#set: inchi-key=inchikey=dwaknkkxgalpnw-bypyzucnsa-m}}

Revision as of 15:09, 15 March 2021

Metabolite L-DELTA1-PYRROLINE_5-CARBOXYLATE

  • common-name:
    • (s)-1-pyrroline-5-carboxylate
  • molecular-weight:
    • 112.108
  • inchi-key:
    • dwaknkkxgalpnw-bypyzucnsa-m
  • smiles:
    • c1(=nc(cc1)c(=o)[o-])

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality