Difference between revisions of "ADP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11495 == * common-name: ** (2-hydroxyphenyl)acetate * molecular-weight: ** 151.141 * inchi-key: ** ccvyrrgzdbshfu-uhfffaoysa-m * smil...") |
(Created page with "Category:metabolite == Metabolite CPD-4618 == * common-name: ** cis-zeatin-7-n-glucoside * molecular-weight: ** 381.388 * inchi-key: ** htdhrclvwuexis-gihywfgssa-n * smile...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-4618 == |
* common-name: | * common-name: | ||
| − | ** | + | ** cis-zeatin-7-n-glucoside |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 381.388 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** htdhrclvwuexis-gihywfgssa-n |
* smiles: | * smiles: | ||
| − | ** c(= | + | ** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-4733]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cis-zeatin-7-n-glucoside}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=381.388}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=htdhrclvwuexis-gihywfgssa-n}} |
Revision as of 15:09, 15 March 2021
Contents
Metabolite CPD-4618
- common-name:
- cis-zeatin-7-n-glucoside
- molecular-weight:
- 381.388
- inchi-key:
- htdhrclvwuexis-gihywfgssa-n
- smiles:
- cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co
