Difference between revisions of "Cellular-Retinol-Binding-Proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BCAA-dehydrogenase-2MP-DH-lipoyl == * common-name: ** an [apo bcaa dehydrogenase e2 protein] n6-s-[2-methylpropanoyl]dihydrolipoyl-l-lysi...") |
(Created page with "Category:metabolite == Metabolite 3Z-PHYTOCHROMOBILIN == * common-name: ** (3z)-phytochromobilin * molecular-weight: ** 582.655 * inchi-key: ** dkmlmzvdtgoegu-aikfxvfzsa-l...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3Z-PHYTOCHROMOBILIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** (3z)-phytochromobilin |
| + | * molecular-weight: | ||
| + | ** 582.655 | ||
| + | * inchi-key: | ||
| + | ** dkmlmzvdtgoegu-aikfxvfzsa-l | ||
| + | * smiles: | ||
| + | ** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[1. | + | * [[1.3.7.4-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(3z)-phytochromobilin}} |
| + | {{#set: molecular-weight=582.655}} | ||
| + | {{#set: inchi-key=inchikey=dkmlmzvdtgoegu-aikfxvfzsa-l}} | ||
Revision as of 15:09, 15 March 2021
Contents
Metabolite 3Z-PHYTOCHROMOBILIN
- common-name:
- (3z)-phytochromobilin
- molecular-weight:
- 582.655
- inchi-key:
- dkmlmzvdtgoegu-aikfxvfzsa-l
- smiles:
- cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o)
