Difference between revisions of "Gamma-linolenoyl-groups"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12904 == * common-name: ** (2e)-5-methylhexa-2,4-dienoyl-coa * molecular-weight: ** 871.642 * inchi-key: ** ifmyvrqehqtins-meoyllpmsa...") |
(Created page with "Category:metabolite == Metabolite CPD-4211 == * common-name: ** prenyl diphosphate * molecular-weight: ** 243.069 * inchi-key: ** cbidrcwhncksto-uhfffaoysa-k * smiles: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-4211 == |
* common-name: | * common-name: | ||
− | ** | + | ** prenyl diphosphate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 243.069 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** cbidrcwhncksto-uhfffaoysa-k |
* smiles: | * smiles: | ||
− | ** cc(c)= | + | ** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[GPPSYN-RXN]] |
+ | * [[IPPISOM-RXN]] | ||
+ | * [[RXN-4303]] | ||
+ | * [[RXN-4305]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[IPPISOM-RXN]] | ||
+ | * [[RXN0-884]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=prenyl diphosphate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=243.069}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cbidrcwhncksto-uhfffaoysa-k}} |
Revision as of 15:09, 15 March 2021
Contents
Metabolite CPD-4211
- common-name:
- prenyl diphosphate
- molecular-weight:
- 243.069
- inchi-key:
- cbidrcwhncksto-uhfffaoysa-k
- smiles:
- cc(c)=ccop(=o)([o-])op(=o)([o-])[o-]