Difference between revisions of "Gamma-linolenoyl-groups"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12904 == * common-name: ** (2e)-5-methylhexa-2,4-dienoyl-coa * molecular-weight: ** 871.642 * inchi-key: ** ifmyvrqehqtins-meoyllpmsa...")
(Created page with "Category:metabolite == Metabolite CPD-4211 == * common-name: ** prenyl diphosphate * molecular-weight: ** 243.069 * inchi-key: ** cbidrcwhncksto-uhfffaoysa-k * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12904 ==
+
== Metabolite CPD-4211 ==
 
* common-name:
 
* common-name:
** (2e)-5-methylhexa-2,4-dienoyl-coa
+
** prenyl diphosphate
 
* molecular-weight:
 
* molecular-weight:
** 871.642
+
** 243.069
 
* inchi-key:
 
* inchi-key:
** ifmyvrqehqtins-meoyllpmsa-j
+
** cbidrcwhncksto-uhfffaoysa-k
 
* smiles:
 
* smiles:
** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11919]]
+
* [[GPPSYN-RXN]]
 +
* [[IPPISOM-RXN]]
 +
* [[RXN-4303]]
 +
* [[RXN-4305]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[IPPISOM-RXN]]
 +
* [[RXN0-884]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e)-5-methylhexa-2,4-dienoyl-coa}}
+
{{#set: common-name=prenyl diphosphate}}
{{#set: molecular-weight=871.642}}
+
{{#set: molecular-weight=243.069}}
{{#set: inchi-key=inchikey=ifmyvrqehqtins-meoyllpmsa-j}}
+
{{#set: inchi-key=inchikey=cbidrcwhncksto-uhfffaoysa-k}}

Revision as of 15:09, 15 March 2021

Metabolite CPD-4211

  • common-name:
    • prenyl diphosphate
  • molecular-weight:
    • 243.069
  • inchi-key:
    • cbidrcwhncksto-uhfffaoysa-k
  • smiles:
    • cc(c)=ccop(=o)([o-])op(=o)([o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality