Difference between revisions of "LYS2-peptidyl-carrier-protein"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-520 == * common-name: ** phosphatidylglycerophosphate (1-octadecenoyl(9z), 2-palmitoyl) * molecular-weight: ** 825.972 * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite TRYPTAMINE == * common-name: ** tryptamine * molecular-weight: ** 161.226 * inchi-key: ** apjydqyyacxcrm-uhfffaoysa-o * smiles: ** c([n+]...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite TRYPTAMINE == |
* common-name: | * common-name: | ||
− | ** | + | ** tryptamine |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 161.226 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** apjydqyyacxcrm-uhfffaoysa-o |
* smiles: | * smiles: | ||
− | ** | + | ** c([n+])cc1(=cnc2(c=cc=cc1=2)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[STRICTOSIDINE-SYNTHASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=tryptamine}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=161.226}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=apjydqyyacxcrm-uhfffaoysa-o}} |
Revision as of 15:09, 15 March 2021
Contents
Metabolite TRYPTAMINE
- common-name:
- tryptamine
- molecular-weight:
- 161.226
- inchi-key:
- apjydqyyacxcrm-uhfffaoysa-o
- smiles:
- c([n+])cc1(=cnc2(c=cc=cc1=2))