Difference between revisions of "NADP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-335 == * common-name: ** (r)-3-hydroxybutanoate * molecular-weight: ** 103.097 * inchi-key: ** whbmmwsbfzvssr-gsvougtgsa-m * smiles:...") |
(Created page with "Category:metabolite == Metabolite CPD0-2123 == * common-name: ** 3-oxodecanoyl-coa * molecular-weight: ** 931.738 * inchi-key: ** azcvxmaplhsiky-hsjnekgzsa-j * smiles: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-2123 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxodecanoyl-coa |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 931.738 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** azcvxmaplhsiky-hsjnekgzsa-j |
* smiles: | * smiles: | ||
− | ** cc( | + | ** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13617]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12490]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-oxodecanoyl-coa}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=931.738}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=azcvxmaplhsiky-hsjnekgzsa-j}} |
Revision as of 15:09, 15 March 2021
Contents
Metabolite CPD0-2123
- common-name:
- 3-oxodecanoyl-coa
- molecular-weight:
- 931.738
- inchi-key:
- azcvxmaplhsiky-hsjnekgzsa-j
- smiles:
- cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]