Difference between revisions of "PALMITYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP == * common-name: ** udp * molecular-weight: ** 401.14 * inchi-key: ** xcctyiawtasojw-xvfcmesisa-k * smiles: ** c(op(=o)([o-])op(=o)(...")
(Created page with "Category:metabolite == Metabolite CPD-12575 == * common-name: ** udp-α-d-glucose * molecular-weight: ** 564.289 * inchi-key: ** hscjrczfdfqwrp-jzmiexbbsa-l * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP ==
+
== Metabolite CPD-12575 ==
 
* common-name:
 
* common-name:
** udp
+
** udp-α-d-glucose
 
* molecular-weight:
 
* molecular-weight:
** 401.14
+
** 564.289
 
* inchi-key:
 
* inchi-key:
** xcctyiawtasojw-xvfcmesisa-k
+
** hscjrczfdfqwrp-jzmiexbbsa-l
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
+
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.198-RXN]]
 
* [[2.4.1.94-RXN]]
 
* [[ExchangeSeed-UDP]]
 
* [[RXN-12197]]
 
* [[RXN-16027]]
 
* [[RXN0-722]]
 
* [[TransportSeed-UDP]]
 
* [[UDPKIN-RXN]]
 
* [[UDPREDUCT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
 
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
* [[2.4.1.101-RXN]]
 
 
* [[2.4.1.117-RXN]]
 
* [[2.4.1.117-RXN]]
* [[2.4.1.141-RXN]]
 
* [[2.4.1.143-RXN]]
 
* [[2.4.1.144-RXN]]
 
* [[2.4.1.145-RXN]]
 
* [[2.4.1.149-RXN]]
 
* [[2.4.1.150-RXN]]
 
* [[2.4.1.151-RXN]]
 
* [[2.4.1.155-RXN]]
 
* [[2.4.1.198-RXN]]
 
* [[2.4.1.201-RXN]]
 
* [[2.4.1.224-RXN]]
 
* [[2.4.1.229-RXN]]
 
* [[2.4.1.38-RXN]]
 
* [[2.4.1.46-RXN]]
 
* [[2.4.1.94-RXN]]
 
* [[2.4.2.26-RXN]]
 
 
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
 
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
* [[ExchangeSeed-UDP]]
+
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
* [[RXN-10606]]
 
* [[RXN-10607]]
 
* [[RXN-10608]]
 
* [[RXN-10609]]
 
* [[RXN-10616]]
 
* [[RXN-10617]]
 
* [[RXN-10618]]
 
* [[RXN-10619]]
 
* [[RXN-10784]]
 
* [[RXN-11060]]
 
* [[RXN-12002]]
 
 
* [[RXN-12123]]
 
* [[RXN-12123]]
 
* [[RXN-12125]]
 
* [[RXN-12125]]
Line 59: Line 22:
 
* [[RXN-12127]]
 
* [[RXN-12127]]
 
* [[RXN-12128]]
 
* [[RXN-12128]]
* [[RXN-12196]]
+
* [[RXN-1223]]
* [[RXN-1224]]
 
* [[RXN-1225]]
 
* [[RXN-13607]]
 
* [[RXN-13608]]
 
* [[RXN-14361]]
 
 
* [[RXN-15117]]
 
* [[RXN-15117]]
* [[RXN-15276]]
 
* [[RXN-15277]]
 
* [[RXN-15278]]
 
* [[RXN-16027]]
 
 
* [[RXN-16975]]
 
* [[RXN-16975]]
 
* [[RXN-4726]]
 
* [[RXN-4726]]
 
* [[RXN-4733]]
 
* [[RXN-4733]]
 +
* [[RXN-5482]]
 
* [[RXN-7828]]
 
* [[RXN-7828]]
 
* [[RXN-8228]]
 
* [[RXN-8228]]
* [[RXN-9000]]
 
 
* [[RXN1F-461]]
 
* [[RXN1F-461]]
 
* [[RXN1F-462]]
 
* [[RXN1F-462]]
* [[RXN66-162]]
 
* [[RXN66-168]]
 
* [[RXN66-83]]
 
 
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 
* [[TREHALOSE6PSYN-RXN]]
 
* [[TREHALOSE6PSYN-RXN]]
* [[TransportSeed-UDP]]
+
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
+
* [[UDPGLUCEPIM-RXN]]
 +
* [[UGD-RXN]]
 
</div>
 
</div>
 +
== Reaction(s) known to produce the compound ==
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[UDPGLUCEPIM-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp}}
+
{{#set: common-name=udp-&alpha;-d-glucose}}
{{#set: molecular-weight=401.14}}
+
{{#set: molecular-weight=564.289}}
{{#set: inchi-key=inchikey=xcctyiawtasojw-xvfcmesisa-k}}
+
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-jzmiexbbsa-l}}

Revision as of 15:09, 15 March 2021