Difference between revisions of "CARBON-DIOXIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12830 == * common-name: ** demethylphylloquinol * molecular-weight: ** 438.692 * inchi-key: ** aefnzggbwoqyid-kqpzccjbsa-n * smiles:...")
(Created page with "Category:metabolite == Metabolite OH-HEXANOYL-COA == * common-name: ** (s)-3-hydroxyhexanoyl-coa * molecular-weight: ** 877.646 * inchi-key: ** vaahkrmgofiorx-dwufxmdisa-j...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12830 ==
+
== Metabolite OH-HEXANOYL-COA ==
 
* common-name:
 
* common-name:
** demethylphylloquinol
+
** (s)-3-hydroxyhexanoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 438.692
+
** 877.646
 
* inchi-key:
 
* inchi-key:
** aefnzggbwoqyid-kqpzccjbsa-n
+
** vaahkrmgofiorx-dwufxmdisa-j
 
* smiles:
 
* smiles:
** cc(cccc(cccc(c)cccc(=ccc2(c=c(o)c1(=c(c=cc=c1)c(o)=2)))c)c)c
+
** cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7569]]
+
* [[RXN-12567]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12570]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylphylloquinol}}
+
{{#set: common-name=(s)-3-hydroxyhexanoyl-coa}}
{{#set: molecular-weight=438.692}}
+
{{#set: molecular-weight=877.646}}
{{#set: inchi-key=inchikey=aefnzggbwoqyid-kqpzccjbsa-n}}
+
{{#set: inchi-key=inchikey=vaahkrmgofiorx-dwufxmdisa-j}}

Revision as of 15:09, 15 March 2021

Metabolite OH-HEXANOYL-COA

  • common-name:
    • (s)-3-hydroxyhexanoyl-coa
  • molecular-weight:
    • 877.646
  • inchi-key:
    • vaahkrmgofiorx-dwufxmdisa-j
  • smiles:
    • cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality