Difference between revisions of "5-Phospho-RNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ARSENATE == * common-name: ** arsenate * molecular-weight: ** 139.927 * inchi-key: ** djhgafsjwgloiv-uhfffaoysa-l * smiles: ** [as](=o)(o...") |
(Created page with "Category:metabolite == Metabolite DEOXYURIDINE == * common-name: ** 2'-deoxyuridine * molecular-weight: ** 228.204 * inchi-key: ** mxhrcpnrjammim-shyzeuofsa-n * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DEOXYURIDINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2'-deoxyuridine |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 228.204 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mxhrcpnrjammim-shyzeuofsa-n |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[CYTIDEAM-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2'-deoxyuridine}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=228.204}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mxhrcpnrjammim-shyzeuofsa-n}} |
Revision as of 15:10, 15 March 2021
Contents
Metabolite DEOXYURIDINE
- common-name:
- 2'-deoxyuridine
- molecular-weight:
- 228.204
- inchi-key:
- mxhrcpnrjammim-shyzeuofsa-n
- smiles:
- c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2))
