Difference between revisions of "Glycogens"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12481 == * common-name: ** 7-methylurate * molecular-weight: ** 182.138 * inchi-key: ** yhnnpkufpwltop-uhfffaoysa-n * smiles: ** cn1(...")
(Created page with "Category:metabolite == Metabolite SUC-COA == * common-name: ** succinyl-coa * molecular-weight: ** 862.568 * inchi-key: ** vnoyujkhfwywir-itiydsspsa-i * smiles: ** cc(c)(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12481 ==
+
== Metabolite SUC-COA ==
 
* common-name:
 
* common-name:
** 7-methylurate
+
** succinyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 182.138
+
** 862.568
 
* inchi-key:
 
* inchi-key:
** yhnnpkufpwltop-uhfffaoysa-n
+
** vnoyujkhfwywir-itiydsspsa-i
 
* smiles:
 
* smiles:
** cn1(c(=o)nc2(=c1c(=o)nc(=o)n2))
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[HOMSUCTRAN-RXN]]
 +
* [[METHYLMALONYL-COA-MUT-RXN]]
 +
* [[RXN0-1147]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11521]]
+
* [[METHYLMALONYL-COA-MUT-RXN]]
 +
* [[RXN0-1147]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7-methylurate}}
+
{{#set: common-name=succinyl-coa}}
{{#set: molecular-weight=182.138}}
+
{{#set: molecular-weight=862.568}}
{{#set: inchi-key=inchikey=yhnnpkufpwltop-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=vnoyujkhfwywir-itiydsspsa-i}}

Revision as of 15:10, 15 March 2021

Metabolite SUC-COA

  • common-name:
    • succinyl-coa
  • molecular-weight:
    • 862.568
  • inchi-key:
    • vnoyujkhfwywir-itiydsspsa-i
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality