Difference between revisions of "METHYL-BETA-D-GALACTOSIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11939 == * common-name: ** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate * molecular-weight: ** 805.885 * inchi-...")
(Created page with "Category:metabolite == Metabolite DMPBQ == * common-name: ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol * molecular-weight: ** 416.686 * inchi-key: ** sufzkubnovdjrr-wgeodtkdsa...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11939 ==
+
== Metabolite DMPBQ ==
 
* common-name:
 
* common-name:
** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate
+
** 2,3-dimethyl-6-phytyl-1,4-benzoquinol
 
* molecular-weight:
 
* molecular-weight:
** 805.885
+
** 416.686
 
* inchi-key:
 
* inchi-key:
** hhqooerqsfjgep-zsiqdkgesa-a
+
** sufzkubnovdjrr-wgeodtkdsa-n
 
* smiles:
 
* smiles:
** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op(=o)([o-])op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op([o-])(=o)[o-])c(op([o-])([o-])=o)1)
+
** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-2543]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10973]]
+
* [[RXN-2542]]
* [[RXN-10979]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate}}
+
{{#set: common-name=2,3-dimethyl-6-phytyl-1,4-benzoquinol}}
{{#set: molecular-weight=805.885}}
+
{{#set: molecular-weight=416.686}}
{{#set: inchi-key=inchikey=hhqooerqsfjgep-zsiqdkgesa-a}}
+
{{#set: inchi-key=inchikey=sufzkubnovdjrr-wgeodtkdsa-n}}

Revision as of 15:10, 15 March 2021

Metabolite DMPBQ

  • common-name:
    • 2,3-dimethyl-6-phytyl-1,4-benzoquinol
  • molecular-weight:
    • 416.686
  • inchi-key:
    • sufzkubnovdjrr-wgeodtkdsa-n
  • smiles:
    • cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality