Difference between revisions of "EIF5A-HYPUSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DI-H-OROTATE == * common-name: ** (s)-dihydroorotate * molecular-weight: ** 157.105 * inchi-key: ** ufivepvsagbusi-reohclbhsa-m * smiles:...")
(Created page with "Category:metabolite == Metabolite ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER == * common-name: ** an n-acetyl-α-neuraminyl-(2→3)-β-d-galactosyl-(1→4)-n-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DI-H-OROTATE ==
+
== Metabolite ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER ==
 
* common-name:
 
* common-name:
** (s)-dihydroorotate
+
** an n-acetyl-α-neuraminyl-(2→3)-β-d-galactosyl-(1→4)-n-acetyl-β-d-glucosaminyl-r
* molecular-weight:
 
** 157.105
 
* inchi-key:
 
** ufivepvsagbusi-reohclbhsa-m
 
* smiles:
 
** c1(c(=o)nc(=o)nc(c(=o)[o-])1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIHYDROOROT-RXN]]
 
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
 
* [[RXN0-6491]]
 
* [[RXN0-6554]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIHYDROOROT-RXN]]
+
* [[2.4.99.6-RXN]]
* [[RXN0-6490]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-dihydroorotate}}
+
{{#set: common-name=an n-acetyl-α-neuraminyl-(2→3)-β-d-galactosyl-(1→4)-n-acetyl-β-d-glucosaminyl-r}}
{{#set: molecular-weight=157.105}}
 
{{#set: inchi-key=inchikey=ufivepvsagbusi-reohclbhsa-m}}
 

Revision as of 15:10, 15 March 2021

Metabolite ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER

  • common-name:
    • an n-acetyl-α-neuraminyl-(2→3)-β-d-galactosyl-(1→4)-n-acetyl-β-d-glucosaminyl-r

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality