Difference between revisions of "5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-hydroxypimeloyl-ACP-methyl-esters == * common-name: ** a (3r)-3-hydroxypimeloyl-[acp] methyl ester == Reaction(s) known to consume the...") |
(Created page with "Category:metabolite == Metabolite CPD-15688 == * common-name: ** (3z,5e)-dodeca-3,5-dienoyl-coa * molecular-weight: ** 941.776 * inchi-key: ** arquzfjqpywssl-nbluimthsa-j...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15688 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (3z,5e)-dodeca-3,5-dienoyl-coa |
| + | * molecular-weight: | ||
| + | ** 941.776 | ||
| + | * inchi-key: | ||
| + | ** arquzfjqpywssl-nbluimthsa-j | ||
| + | * smiles: | ||
| + | ** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14799]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(3z,5e)-dodeca-3,5-dienoyl-coa}} |
| + | {{#set: molecular-weight=941.776}} | ||
| + | {{#set: inchi-key=inchikey=arquzfjqpywssl-nbluimthsa-j}} | ||
Revision as of 15:10, 15 March 2021
Contents
Metabolite CPD-15688
- common-name:
- (3z,5e)-dodeca-3,5-dienoyl-coa
- molecular-weight:
- 941.776
- inchi-key:
- arquzfjqpywssl-nbluimthsa-j
- smiles:
- ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
