Difference between revisions of "TRANS-D2-ENOYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15678 == * common-name: ** 4-trans-3-oxo-undecenoyl-coa * molecular-weight: ** 943.749 * inchi-key: ** xbfqfvlnmjddng-dupkwvsksa-j *...")
(Created page with "Category:metabolite == Metabolite CPD-17621 == * common-name: ** 16-hydroxypalmitoyl-coa * molecular-weight: ** 1017.914 * inchi-key: ** rozgnndroqhxpf-bbecnahfsa-j * smil...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15678 ==
+
== Metabolite CPD-17621 ==
 
* common-name:
 
* common-name:
** 4-trans-3-oxo-undecenoyl-coa
+
** 16-hydroxypalmitoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 943.749
+
** 1017.914
 
* inchi-key:
 
* inchi-key:
** xbfqfvlnmjddng-dupkwvsksa-j
+
** rozgnndroqhxpf-bbecnahfsa-j
 
* smiles:
 
* smiles:
** ccccccc=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccccccccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14793]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16389]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-trans-3-oxo-undecenoyl-coa}}
+
{{#set: common-name=16-hydroxypalmitoyl-coa}}
{{#set: molecular-weight=943.749}}
+
{{#set: molecular-weight=1017.914}}
{{#set: inchi-key=inchikey=xbfqfvlnmjddng-dupkwvsksa-j}}
+
{{#set: inchi-key=inchikey=rozgnndroqhxpf-bbecnahfsa-j}}

Revision as of 15:10, 15 March 2021

Metabolite CPD-17621

  • common-name:
    • 16-hydroxypalmitoyl-coa
  • molecular-weight:
    • 1017.914
  • inchi-key:
    • rozgnndroqhxpf-bbecnahfsa-j
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccccccccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality