Difference between revisions of "Beta-Lactams"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16001 == * common-name: ** (11z)-hexadecenoyl-coa * molecular-weight: ** 999.899 * inchi-key: ** lfnouyufxgxnnp-ubpkjmqesa-j * smiles...")
(Created page with "Category:metabolite == Metabolite DTDP-DEOH-DEOXY-GLUCOSE == * common-name: ** dtdp-4-dehydro-6-deoxy-α-d-glucopyranose * molecular-weight: ** 544.302 * inchi-key: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-16001 ==
+
== Metabolite DTDP-DEOH-DEOXY-GLUCOSE ==
 
* common-name:
 
* common-name:
** (11z)-hexadecenoyl-coa
+
** dtdp-4-dehydro-6-deoxy-α-d-glucopyranose
 
* molecular-weight:
 
* molecular-weight:
** 999.899
+
** 544.302
 
* inchi-key:
 
* inchi-key:
** lfnouyufxgxnnp-ubpkjmqesa-j
+
** psxwnitxwwecny-ucbtuhgzsa-l
 
* smiles:
 
* smiles:
** ccccc=ccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16557]]
+
* [[DTDPDEHYDRHAMEPIM-RXN]]
 +
* [[DTDPRHAMSYNTHMULTI-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DTDPGLUCDEHYDRAT-RXN]]
 +
* [[DTDPRHAMSYNTHMULTI-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(11z)-hexadecenoyl-coa}}
+
{{#set: common-name=dtdp-4-dehydro-6-deoxy-α-d-glucopyranose}}
{{#set: molecular-weight=999.899}}
+
{{#set: molecular-weight=544.302}}
{{#set: inchi-key=inchikey=lfnouyufxgxnnp-ubpkjmqesa-j}}
+
{{#set: inchi-key=inchikey=psxwnitxwwecny-ucbtuhgzsa-l}}

Revision as of 15:11, 15 March 2021

Metabolite DTDP-DEOH-DEOXY-GLUCOSE

  • common-name:
    • dtdp-4-dehydro-6-deoxy-α-d-glucopyranose
  • molecular-weight:
    • 544.302
  • inchi-key:
    • psxwnitxwwecny-ucbtuhgzsa-l
  • smiles:
    • cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality