Difference between revisions of "3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-4 == * common-name: ** β-l-galactose 1-phosphate * molecular-weight: ** 258.121 * inchi-key: ** hxxfsfrbohsimq-sxuwkvjysa-l *...")
(Created page with "Category:metabolite == Metabolite N-ACETYL-BETA-D-GLUCOSAMINYL-13-ETCETERA == * common-name: ** an n-acetyl-β-d-glucosaminyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPDQT-4 ==
+
== Metabolite N-ACETYL-BETA-D-GLUCOSAMINYL-13-ETCETERA ==
 
* common-name:
 
* common-name:
−
** β-l-galactose 1-phosphate
+
** an n-acetyl-β-d-glucosaminyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-β-d-glucosaminyl-r
−
* molecular-weight:
 
−
** 258.121
 
−
* inchi-key:
 
−
** hxxfsfrbohsimq-sxuwkvjysa-l
 
−
* smiles:
 
−
** c(o)c1(c(o)c(o)c(o)c(op([o-])([o-])=o)o1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXNQT-4142]]
+
* [[RXN-15276]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXNQT-4141]]
+
* [[2.4.1.149-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=β-l-galactose 1-phosphate}}
+
{{#set: common-name=an n-acetyl-β-d-glucosaminyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-β-d-glucosaminyl-r}}
−
{{#set: molecular-weight=258.121}}
 
−
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-sxuwkvjysa-l}}
 

Revision as of 15:11, 15 March 2021

Metabolite N-ACETYL-BETA-D-GLUCOSAMINYL-13-ETCETERA

  • common-name:
    • an n-acetyl-β-d-glucosaminyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-β-d-glucosaminyl-r

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE&oldid=28793"