Difference between revisions of "CPD-16758"

Revision as of 15:11, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite L-HISTIDINOL-P ==
+== Metabolite D-glucopyranose-6-phosphate ==
 * common-name:
-** l-histidinol phosphate
+** d-glucopyranose 6-phosphate
-* molecular-weight:
-** 220.144
-* inchi-key:
-** cwnderhthmwbsi-yfkpbyrvsa-m
-* smiles:
-** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+])
 == Reaction(s) known to consume the compound ==
-* [[HISTAMINOTRANS-RXN]]
+* [[GLU6PDEHYDROG-RXN]]
-* [[HISTIDPHOS-RXN]]
+* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
+* [[PGLUCISOM-RXN]]
+* [[PHOSPHOGLUCMUT-RXN]]
+* [[RXN66-526]]
+* [[TREHALOSE6PSYN-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[HISTAMINOTRANS-RXN]]
+* [[GLUCOKIN-RXN]]
+* [[PGLUCISOM-RXN]]
+* [[PHOSPHOGLUCMUT-RXN]]
+* [[RXN-16998]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=l-histidinol phosphate}}
+{{#set: common-name=d-glucopyranose 6-phosphate}}
-{{#set: molecular-weight=220.144}}
-{{#set: inchi-key=inchikey=cwnderhthmwbsi-yfkpbyrvsa-m}}