Difference between revisions of "CPD-696"

Revision as of 15:11, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CDP-ETHANOLAMINE ==
+== Metabolite CPD-68 ==
 * common-name:
-** cdp-ethanolamine
+** 1-aminocyclopropane-1-carboxylate
 * molecular-weight:
-** 445.239
+** 101.105
 * inchi-key:
-** wvimueuqjfpndk-pebgctimsa-m
+** pajpwumxbyxfcz-uhfffaoysa-n
 * smiles:
-** c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+]
+** c([o-])(=o)c1(cc1)[n+]
 == Reaction(s) known to consume the compound ==
-* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[2.7.7.14-RXN]]
+* [[4.4.1.14-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=cdp-ethanolamine}}
+{{#set: common-name=1-aminocyclopropane-1-carboxylate}}
-{{#set: molecular-weight=445.239}}
+{{#set: molecular-weight=101.105}}
-{{#set: inchi-key=inchikey=wvimueuqjfpndk-pebgctimsa-m}}
+{{#set: inchi-key=inchikey=pajpwumxbyxfcz-uhfffaoysa-n}}