Difference between revisions of "S-Substituted-Glutathione"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-649 == * common-name: ** sphinganine 1-phosphate * molecular-weight: ** 380.484 * inchi-key: ** yhedrjpuirmzmp-zwkotpchsa-m * smiles:...") |
(Created page with "Category:metabolite == Metabolite CPD-15365 == * common-name: ** densipoloyl-coa * molecular-weight: ** 1041.936 * inchi-key: ** qebzgoipmjeisg-apevuuacsa-j * smiles: ** c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-15365 == |
* common-name: | * common-name: | ||
| − | ** | + | ** densipoloyl-coa |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 1041.936 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qebzgoipmjeisg-apevuuacsa-j |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16150]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-16150]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=densipoloyl-coa}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=1041.936}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qebzgoipmjeisg-apevuuacsa-j}} |
Revision as of 15:11, 15 March 2021
Contents
Metabolite CPD-15365
- common-name:
- densipoloyl-coa
- molecular-weight:
- 1041.936
- inchi-key:
- qebzgoipmjeisg-apevuuacsa-j
- smiles:
- ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
