Difference between revisions of "CPD-201"

Revision as of 15:11, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite MESO-DIAMINOPIMELATE ==
+== Metabolite Red-Thioredoxin ==
 * common-name:
-** meso-diaminopimelate
+** a reduced thioredoxin
-* molecular-weight:
-** 190.199
-* inchi-key:
-** gmkmezvlhjarhf-sydprgilsa-n
-* smiles:
-** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
 == Reaction(s) known to consume the compound ==
-* [[DIAMINOPIMDECARB-RXN]]
+* [[1.11.1.15-RXN]]
-* [[DIAMINOPIMEPIM-RXN]]
+* [[1.8.4.12-RXN]]
+* [[1.8.4.13-RXN]]
+* [[ADPREDUCT-RXN]]
+* [[CDPREDUCT-RXN]]
+* [[GDPREDUCT-RXN]]
+* [[MERCAPYSTRANS-RXN]]
+* [[RIBONUCLEOSIDE-DIP-REDUCTI-RXN]]
+* [[RXN-8668]]
+* [[RXN0-267]]
+* [[RXN0-5468]]
+* [[THIOREDOXIN-RXN]]
+* [[UDPREDUCT-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[DIAMINOPIMEPIM-RXN]]
+* [[THIOREDOXIN-REDUCT-NADPH-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=meso-diaminopimelate}}
+{{#set: common-name=a reduced thioredoxin}}
-{{#set: molecular-weight=190.199}}
-{{#set: inchi-key=inchikey=gmkmezvlhjarhf-sydprgilsa-n}}