Difference between revisions of "TRP-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHYTOENE == * common_name: ** all-trans-phytoene * smiles: ** cc(=cccc(=cccc(=cccc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c * inchi_k...") |
(Created page with "Category:metabolite == Metabolite CPD-11602 == * common-name: ** ergosterol 3-o-β-d-glucoside * molecular-weight: ** 558.797 * inchi-key: ** mkzpngbjjjzjmi-vnwfyegesa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11602 == |
| − | * | + | * common-name: |
| − | ** | + | ** ergosterol 3-o-β-d-glucoside |
| + | * molecular-weight: | ||
| + | ** 558.797 | ||
| + | * inchi-key: | ||
| + | ** mkzpngbjjjzjmi-vnwfyegesa-n | ||
* smiles: | * smiles: | ||
| − | ** cc(= | + | ** cc(c)c(c)c=cc(c)[ch]4(cc[ch]5(c3(=cc=c2(cc(oc1(oc(co)c(o)c(o)c(o)1))ccc(c)2[ch]3ccc(c)45)))) |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16975]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common-name=ergosterol 3-o-β-d-glucoside}} |
| − | {{#set: | + | {{#set: molecular-weight=558.797}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=mkzpngbjjjzjmi-vnwfyegesa-n}} |
Revision as of 15:11, 15 March 2021
Contents
Metabolite CPD-11602
- common-name:
- ergosterol 3-o-β-d-glucoside
- molecular-weight:
- 558.797
- inchi-key:
- mkzpngbjjjzjmi-vnwfyegesa-n
- smiles:
- cc(c)c(c)c=cc(c)[ch]4(cc[ch]5(c3(=cc=c2(cc(oc1(oc(co)c(o)c(o)c(o)1))ccc(c)2[ch]3ccc(c)45))))
