Difference between revisions of "PLASTOQUINONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15663 == * common-name: ** 2-trans-nonenoyl-coa * molecular-weight: ** 901.711 * inchi-key: ** hblotzdypzazle-owqwvslfsa-j * smiles:...") |
(Created page with "Category:metabolite == Metabolite CPD-4441 == * common-name: ** cis-zeatin * molecular-weight: ** 219.246 * inchi-key: ** uzkqtcbamswpjd-uqcoibpssa-n * smiles: ** cc(co)=c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-4441 == |
* common-name: | * common-name: | ||
− | ** | + | ** cis-zeatin |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 219.246 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** uzkqtcbamswpjd-uqcoibpssa-n |
* smiles: | * smiles: | ||
− | ** | + | ** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-4733]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=cis-zeatin}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=219.246}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uzkqtcbamswpjd-uqcoibpssa-n}} |
Revision as of 15:11, 15 March 2021
Contents
Metabolite CPD-4441
- common-name:
- cis-zeatin
- molecular-weight:
- 219.246
- inchi-key:
- uzkqtcbamswpjd-uqcoibpssa-n
- smiles:
- cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2))