Difference between revisions of "S-CD-S-SP-Complex"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BUTYRYL-COA == * common-name: ** butanoyl-coa * molecular-weight: ** 833.593 * inchi-key: ** crfngmnykdxrtn-hdrjhvaisa-j * smiles: ** ccc...") |
(Created page with "Category:metabolite == Metabolite MYRICETIN == * common-name: ** myricetin * molecular-weight: ** 317.231 * inchi-key: ** ikmdfbphznjcsn-uhfffaoysa-m * smiles: ** c1(c(o)=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MYRICETIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** myricetin |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 317.231 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ikmdfbphznjcsn-uhfffaoysa-m |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c(o)=c(o)c(o)=cc=1c2(oc3(c=c(o)c=c(o)c(c(=o)c([o-])=2)=3))) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-8450]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=myricetin}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=317.231}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ikmdfbphznjcsn-uhfffaoysa-m}} |
Revision as of 15:11, 15 March 2021
Contents
Metabolite MYRICETIN
- common-name:
- myricetin
- molecular-weight:
- 317.231
- inchi-key:
- ikmdfbphznjcsn-uhfffaoysa-m
- smiles:
- c1(c(o)=c(o)c(o)=cc=1c2(oc3(c=c(o)c=c(o)c(c(=o)c([o-])=2)=3)))
