Difference between revisions of "MYO-INOSITOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THZ-P == * common-name: ** 4-methyl-5-(2-phosphooxyethyl)thiazole * molecular-weight: ** 221.167 * inchi-key: ** ocymerzcmyjqqo-uhfffaoys...")
(Created page with "Category:metabolite == Metabolite CPD0-1028 == * common-name: ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate * molecular-weight: ** 447.424 * inchi-key: ** oinneunvo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THZ-P ==
+
== Metabolite CPD0-1028 ==
 
* common-name:
 
* common-name:
** 4-methyl-5-(2-phosphooxyethyl)thiazole
+
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
 
* molecular-weight:
 
* molecular-weight:
** 221.167
+
** 447.424
 
* inchi-key:
 
* inchi-key:
** ocymerzcmyjqqo-uhfffaoysa-l
+
** oinneunvozhbox-kwbdajkesa-k
 
* smiles:
 
* smiles:
** cc1(n=csc(ccop([o-])(=o)[o-])=1)
+
** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[THI-P-SYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-5180]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-methyl-5-(2-phosphooxyethyl)thiazole}}
+
{{#set: common-name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
{{#set: molecular-weight=221.167}}
+
{{#set: molecular-weight=447.424}}
{{#set: inchi-key=inchikey=ocymerzcmyjqqo-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=oinneunvozhbox-kwbdajkesa-k}}

Revision as of 15:11, 15 March 2021

Metabolite CPD0-1028

  • common-name:
    • 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
  • molecular-weight:
    • 447.424
  • inchi-key:
    • oinneunvozhbox-kwbdajkesa-k
  • smiles:
    • cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality