Difference between revisions of "MYO-INOSITOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THZ-P == * common-name: ** 4-methyl-5-(2-phosphooxyethyl)thiazole * molecular-weight: ** 221.167 * inchi-key: ** ocymerzcmyjqqo-uhfffaoys...") |
(Created page with "Category:metabolite == Metabolite CPD0-1028 == * common-name: ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate * molecular-weight: ** 447.424 * inchi-key: ** oinneunvo...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-1028 == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 447.424 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** oinneunvozhbox-kwbdajkesa-k |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN0-5180]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=447.424}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oinneunvozhbox-kwbdajkesa-k}} |
Revision as of 15:11, 15 March 2021
Contents
Metabolite CPD0-1028
- common-name:
- 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
- molecular-weight:
- 447.424
- inchi-key:
- oinneunvozhbox-kwbdajkesa-k
- smiles:
- cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c