Difference between revisions of "M7G5-pppR-mRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACET == * common-name: ** acetate * molecular-weight: ** 59.044 * inchi-key: ** qtbsbxvteameqo-uhfffaoysa-m * smiles: ** cc([o-])=o == Re...")
(Created page with "Category:metabolite == Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-heptaprenyl diphosphate * molecular-weight: ** 651.779 * inchi-key: ** l...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACET ==
+
== Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE ==
 
* common-name:
 
* common-name:
** acetate
+
** all-trans-heptaprenyl diphosphate
 
* molecular-weight:
 
* molecular-weight:
** 59.044
+
** 651.779
 
* inchi-key:
 
* inchi-key:
** qtbsbxvteameqo-uhfffaoysa-m
+
** lsjlexwxrktzaj-yuiipxgzsa-k
 
* smiles:
 
* smiles:
** cc([o-])=o
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETATE--COA-LIGASE-RXN]]
+
* [[RXN-9222]]
* [[ACETYLORNDEACET-RXN]]
 
* [[ACSERLY-RXN]]
 
* [[CITRAMALATE-LYASE-RXN]]
 
* [[SULFOCYS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.1.47-RXN]]
 
* [[3.1.1.69-RXN]]
 
* [[3.5.1.98-RXN]]
 
* [[ACETYLORNDEACET-RXN]]
 
* [[ACSERLY-RXN]]
 
* [[CITRAMALATE-LYASE-RXN]]
 
* [[RXN-12726]]
 
* [[RXN-13684]]
 
* [[RXN0-3962]]
 
* [[RXN66-3]]
 
* [[SULFOCYS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=acetate}}
+
{{#set: common-name=all-trans-heptaprenyl diphosphate}}
{{#set: molecular-weight=59.044}}
+
{{#set: molecular-weight=651.779}}
{{#set: inchi-key=inchikey=qtbsbxvteameqo-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=lsjlexwxrktzaj-yuiipxgzsa-k}}

Revision as of 15:12, 15 March 2021

Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE

  • common-name:
    • all-trans-heptaprenyl diphosphate
  • molecular-weight:
    • 651.779
  • inchi-key:
    • lsjlexwxrktzaj-yuiipxgzsa-k
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality