Difference between revisions of "Beta-D-Glucans"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BETA-TOCOPHEROL == * common-name: ** β-tocopherol * molecular-weight: ** 416.686 * inchi-key: ** wgvkwnupngfdfj-dqczwyhmsa-n * smile...")
(Created page with "Category:metabolite == Metabolite 12-EPOXYPROPANE == * common-name: ** 1,2-epoxypropane == Reaction(s) known to consume the compound == * RXN-17617 * RXN-17622 ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BETA-TOCOPHEROL ==
+
== Metabolite 12-EPOXYPROPANE ==
 
* common-name:
 
* common-name:
** β-tocopherol
+
** 1,2-epoxypropane
* molecular-weight:
 
** 416.686
 
* inchi-key:
 
** wgvkwnupngfdfj-dqczwyhmsa-n
 
* smiles:
 
** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17617]]
 +
* [[RXN-17622]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2562]]
+
* [[RXN-17622]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-tocopherol}}
+
{{#set: common-name=1,2-epoxypropane}}
{{#set: molecular-weight=416.686}}
 
{{#set: inchi-key=inchikey=wgvkwnupngfdfj-dqczwyhmsa-n}}
 

Revision as of 15:12, 15 March 2021

Metabolite 12-EPOXYPROPANE

  • common-name:
    • 1,2-epoxypropane

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality