Difference between revisions of "Chap-ADP-apo-SP-Complex"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Chap-ADP-apo-SP-Complex == * common-name: ** a [chaperone-adp]-[disordered-form scaffold protein] complex == Reaction(s) known to consume...") |
(Created page with "Category:metabolite == Metabolite DTDP-D-GLUCOSE == * common-name: ** dtdp-α-d-glucose * molecular-weight: ** 562.317 * inchi-key: ** ysykrgrsmltjnl-urarbognsa-l * s...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DTDP-D-GLUCOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** dtdp-α-d-glucose |
+ | * molecular-weight: | ||
+ | ** 562.317 | ||
+ | * inchi-key: | ||
+ | ** ysykrgrsmltjnl-urarbognsa-l | ||
+ | * smiles: | ||
+ | ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(co)c(o)c(o)c(o)2))o3)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[DTDPGLUCDEHYDRAT-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dtdp-α-d-glucose}} |
+ | {{#set: molecular-weight=562.317}} | ||
+ | {{#set: inchi-key=inchikey=ysykrgrsmltjnl-urarbognsa-l}} |
Revision as of 15:12, 15 March 2021
Contents
Metabolite DTDP-D-GLUCOSE
- common-name:
- dtdp-α-d-glucose
- molecular-weight:
- 562.317
- inchi-key:
- ysykrgrsmltjnl-urarbognsa-l
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(co)c(o)c(o)c(o)2))o3))