Difference between revisions of "E-"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-N-ACETYLMURAMATE == * common-name: ** udp-n-acetyl-α-d-muramate * molecular-weight: ** 676.397 * inchi-key: ** nqbrvzndbbmblj-m...")
(Created page with "Category:metabolite == Metabolite Beta-D-Glucans == * common-name: ** a β-d glucan == Reaction(s) known to consume the compound == == Reaction(s) known to produce the...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-N-ACETYLMURAMATE ==
+
== Metabolite Beta-D-Glucans ==
 
* common-name:
 
* common-name:
** udp-n-acetyl-α-d-muramate
+
** a β-d glucan
* molecular-weight:
 
** 676.397
 
* inchi-key:
 
** nqbrvzndbbmblj-mqtlhlsbsa-k
 
* smiles:
 
** cc(c([o-])=o)oc3(c(o)c(co)oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(nc(c)=o)3)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
+
* [[3.2.1.6-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-n-acetyl-α-d-muramate}}
+
{{#set: common-name=a β-d glucan}}
{{#set: molecular-weight=676.397}}
 
{{#set: inchi-key=inchikey=nqbrvzndbbmblj-mqtlhlsbsa-k}}
 

Revision as of 15:12, 15 March 2021

Metabolite Beta-D-Glucans

  • common-name:
    • a β-d glucan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality