Difference between revisions of "Alpha-D-Mannosides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite IMINOASPARTATE == * common-name: ** 2-iminosuccinate * molecular-weight: ** 129.072 * inchi-key: ** nmuoatvllqeyhi-uhfffaoysa-l * smiles:...")
(Created page with "Category:metabolite == Metabolite 3-Methyl-Saturated-Fatty-Acyl-CoA == * common-name: ** a 3-methyl-branched 2,3,4-saturated fatty acyl-coa == Reaction(s) known to consume...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite IMINOASPARTATE ==
+
== Metabolite 3-Methyl-Saturated-Fatty-Acyl-CoA ==
 
* common-name:
 
* common-name:
** 2-iminosuccinate
+
** a 3-methyl-branched 2,3,4-saturated fatty acyl-coa
* molecular-weight:
 
** 129.072
 
* inchi-key:
 
** nmuoatvllqeyhi-uhfffaoysa-l
 
* smiles:
 
** c(=o)([o-])cc(=n)c(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[QUINOLINATE-SYNTHA-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[L-ASPARTATE-OXID-RXN]]
+
* [[RXN66-469]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-iminosuccinate}}
+
{{#set: common-name=a 3-methyl-branched 2,3,4-saturated fatty acyl-coa}}
{{#set: molecular-weight=129.072}}
 
{{#set: inchi-key=inchikey=nmuoatvllqeyhi-uhfffaoysa-l}}
 

Revision as of 15:12, 15 March 2021

Metabolite 3-Methyl-Saturated-Fatty-Acyl-CoA

  • common-name:
    • a 3-methyl-branched 2,3,4-saturated fatty acyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality