Difference between revisions of "CPD-2961"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-824 == * common_name: ** 5-guanidino-2-oxo-pentanoate * smiles: ** c(c(cccnc(n)=[n+])=o)(=o)[o-] * inchi_key: ** inchikey=arbhxjxxvvh...") |
(Created page with "Category:metabolite == Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P == * common-name: ** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate * molecular-weight: ** 346...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P == |
| − | * | + | * common-name: |
| − | ** 5- | + | ** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate |
| + | * molecular-weight: | ||
| + | ** 346.21 | ||
| + | * inchi-key: | ||
| + | ** qkmbynrmprkvto-mnovxskesa-k | ||
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cnc1(c=cc=cc(c(=o)[o-])=1) |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[IGPSYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PRAISOM-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common-name=1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate}} |
| − | {{#set: | + | {{#set: molecular-weight=346.21}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=qkmbynrmprkvto-mnovxskesa-k}} |
Revision as of 15:12, 15 March 2021
Contents
Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P
- common-name:
- 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate
- molecular-weight:
- 346.21
- inchi-key:
- qkmbynrmprkvto-mnovxskesa-k
- smiles:
- c(op(=o)([o-])[o-])c(o)c(o)c(=o)cnc1(c=cc=cc(c(=o)[o-])=1)
