Difference between revisions of "Protein-L-Asparagine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Oxidized-Plastocyanins == * common-name: ** an oxidized plastocyanin == Reaction(s) known to consume the compound == * PLASTOQUINOL--PL...")
(Created page with "Category:metabolite == Metabolite 3-P-SERINE == * common-name: ** 3-phospho-l-serine * molecular-weight: ** 183.057 * inchi-key: ** bzqfbwgglxlepq-reohclbhsa-l * smiles: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Oxidized-Plastocyanins ==
+
== Metabolite 3-P-SERINE ==
 
* common-name:
 
* common-name:
** an oxidized plastocyanin
+
** 3-phospho-l-serine
 +
* molecular-weight:
 +
** 183.057
 +
* inchi-key:
 +
** bzqfbwgglxlepq-reohclbhsa-l
 +
* smiles:
 +
** c(op([o-])([o-])=o)c([n+])c(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN]]
+
* [[PSERTRANSAM-RXN]]
* [[RXN-12647]]
+
* [[RXN0-5114]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[PSERTRANSAM-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an oxidized plastocyanin}}
+
{{#set: common-name=3-phospho-l-serine}}
 +
{{#set: molecular-weight=183.057}}
 +
{{#set: inchi-key=inchikey=bzqfbwgglxlepq-reohclbhsa-l}}

Revision as of 15:12, 15 March 2021

Metabolite 3-P-SERINE

  • common-name:
    • 3-phospho-l-serine
  • molecular-weight:
    • 183.057
  • inchi-key:
    • bzqfbwgglxlepq-reohclbhsa-l
  • smiles:
    • c(op([o-])([o-])=o)c([n+])c(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality