Difference between revisions of "TRNA-pseudouridine-38-40"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12303 == * common-name: ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine * molecular-weight:...")
(Created page with "Category:metabolite == Metabolite 3-5-ADP == * common-name: ** adenosine 3',5'-bisphosphate * molecular-weight: ** 423.172 * inchi-key: ** whtcpdaxwfldih-kqynxxcusa-j * sm...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-12303 ==
+
== Metabolite 3-5-ADP ==
 
* common-name:
 
* common-name:
−
** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine
+
** adenosine 3',5'-bisphosphate
 
* molecular-weight:
 
* molecular-weight:
−
** 1598.955
+
** 423.172
 
* inchi-key:
 
* inchi-key:
−
** kcrofjgxxschga-ygmfixcysa-k
+
** whtcpdaxwfldih-kqynxxcusa-j
 
* smiles:
 
* smiles:
−
** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(op([o-])(=o)oc1(c(nc(=o)c)c(oc(c)c(=o)nc(c)c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc[n+])c(nc(c)c(=o)[o-])=o)c(o)c(co)o1))([o-])=o)c)c)c)c)c)c)c
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)op(=o)([o-])[o-]))op([o-])([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[325-BISPHOSPHATE-NUCLEOTIDASE-RXN]]
 +
* [[RXN-10994]]
 +
* [[RXN-15589]]
 +
* [[RXN-16759]]
 +
* [[RXN-17203]]
 +
* [[RXN-701]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-11347]]
+
* [[ARYL-SULFOTRANSFERASE-RXN]]
 +
* [[ENTDB-RXN]]
 +
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
 +
* [[HOLO-ACP-SYNTH-RXN]]
 +
* [[RXN-10614]]
 +
* [[RXN-10615]]
 +
* [[RXN-10777]]
 +
* [[RXN-10782]]
 +
* [[RXN-10994]]
 +
* [[RXN-11058]]
 +
* [[RXN-11059]]
 +
* [[RXN-15587]]
 +
* [[RXN-15588]]
 +
* [[RXN-15589]]
 +
* [[RXN-15889]]
 +
* [[RXN-16759]]
 +
* [[RXN-17203]]
 +
* [[RXN-701]]
 +
* [[RXN6666-9]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine}}
+
{{#set: common-name=adenosine 3',5'-bisphosphate}}
−
{{#set: molecular-weight=1598.955}}
+
{{#set: molecular-weight=423.172}}
−
{{#set: inchi-key=inchikey=kcrofjgxxschga-ygmfixcysa-k}}
+
{{#set: inchi-key=inchikey=whtcpdaxwfldih-kqynxxcusa-j}}

Revision as of 15:12, 15 March 2021

Metabolite 3-5-ADP

  • common-name:
    • adenosine 3',5'-bisphosphate
  • molecular-weight:
    • 423.172
  • inchi-key:
    • whtcpdaxwfldih-kqynxxcusa-j
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)op(=o)([o-])[o-]))op([o-])([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=TRNA-pseudouridine-38-40&oldid=29132"