Difference between revisions of "CDP-2-3-4-Saturated-Diacylglycerols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11700 == * common-name: ** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate * molecular-weight: ** 726.913 * inchi-key: ** u...")
(Created page with "Category:metabolite == Metabolite CPD-17045 == * common-name: ** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine * molecular-weight: ** 266.253 * inchi-key: ** p...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-11700 ==
+
== Metabolite CPD-17045 ==
 
* common-name:
 
* common-name:
−
** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate
+
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
 
* molecular-weight:
 
* molecular-weight:
−
** 726.913
+
** 266.253
 
* inchi-key:
 
* inchi-key:
−
** uphpwxpnziozjl-uotptpdrsa-a
+
** pxypzmrmtkvysm-vxgbxaggsa-n
 
* smiles:
 
* smiles:
−
** c1(op(=o)([o-])[o-])(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])1)
+
** c(o)c2(o)(nc(=o)c(o)(cc1(=cc=cc=c1))nc(=o)2)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-10974]]
+
* [[RXN-15680]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10972]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate}}
+
{{#set: common-name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
−
{{#set: molecular-weight=726.913}}
+
{{#set: molecular-weight=266.253}}
−
{{#set: inchi-key=inchikey=uphpwxpnziozjl-uotptpdrsa-a}}
+
{{#set: inchi-key=inchikey=pxypzmrmtkvysm-vxgbxaggsa-n}}

Revision as of 15:12, 15 March 2021

Metabolite CPD-17045

  • common-name:
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
  • molecular-weight:
    • 266.253
  • inchi-key:
    • pxypzmrmtkvysm-vxgbxaggsa-n
  • smiles:
    • c(o)c2(o)(nc(=o)c(o)(cc1(=cc=cc=c1))nc(=o)2)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=CDP-2-3-4-Saturated-Diacylglycerols&oldid=29147"