Difference between revisions of "2-Lysophosphatidylcholines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA == * common-name: ** (2s,3s)-3-hydroxy-2-methylbutanoyl-coa * molecular-weight: ** 863.619 * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite PHENYL-PYRUVATE == * common-name: ** 3-phenyl-2-oxopropanoate * molecular-weight: ** 163.152 * inchi-key: ** btnmpgbkdvtsjy-uhfffaoysa-m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA ==
+
== Metabolite PHENYL-PYRUVATE ==
 
* common-name:
 
* common-name:
** (2s,3s)-3-hydroxy-2-methylbutanoyl-coa
+
** 3-phenyl-2-oxopropanoate
 
* molecular-weight:
 
* molecular-weight:
** 863.619
+
** 163.152
 
* inchi-key:
 
* inchi-key:
** pekyntfsobaabv-lqudnsjzsa-j
+
** btnmpgbkdvtsjy-uhfffaoysa-m
 
* smiles:
 
* smiles:
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c(c)o
+
** c([o-])(=o)c(=o)cc1(=cc=cc=c1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.178-RXN]]
+
* [[2.6.1.58-RXN]]
* [[TIGLYLCOA-HYDROXY-RXN]]
+
* [[PHEAMINOTRANS-RXN]]
 +
* [[PHENYLPYRUVATE-TAUTOMERASE-RXN]]
 +
* [[PREPHENATEDEHYDRAT-RXN]]
 +
* [[RXN-10814]]
 +
* [[RXN-10815]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.178-RXN]]
+
* [[2.6.1.58-RXN]]
* [[TIGLYLCOA-HYDROXY-RXN]]
+
* [[PHEAMINOTRANS-RXN]]
 +
* [[PREPHENATEDEHYDRAT-RXN]]
 +
* [[RXN-10814]]
 +
* [[RXN-17130]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2s,3s)-3-hydroxy-2-methylbutanoyl-coa}}
+
{{#set: common-name=3-phenyl-2-oxopropanoate}}
{{#set: molecular-weight=863.619}}
+
{{#set: molecular-weight=163.152}}
{{#set: inchi-key=inchikey=pekyntfsobaabv-lqudnsjzsa-j}}
+
{{#set: inchi-key=inchikey=btnmpgbkdvtsjy-uhfffaoysa-m}}

Revision as of 15:12, 15 March 2021

Metabolite PHENYL-PYRUVATE

  • common-name:
    • 3-phenyl-2-oxopropanoate
  • molecular-weight:
    • 163.152
  • inchi-key:
    • btnmpgbkdvtsjy-uhfffaoysa-m
  • smiles:
    • c([o-])(=o)c(=o)cc1(=cc=cc=c1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality