Difference between revisions of "CPD-9700"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6993 == * common-name: ** pinocembrin chalcone * molecular-weight: ** 256.257 * inchi-key: ** loyxtwzxlwhmbx-votsokgwsa-n * smiles: *...")
(Created page with "Category:metabolite == Metabolite CPD-415 == * common-name: ** a 1-long-chain acyl-glycerone 3-phosphate == Reaction(s) known to consume the compound == * ALKYLGLYCERONE...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6993 ==
+
== Metabolite CPD-415 ==
 
* common-name:
 
* common-name:
** pinocembrin chalcone
+
** a 1-long-chain acyl-glycerone 3-phosphate
* molecular-weight:
 
** 256.257
 
* inchi-key:
 
** loyxtwzxlwhmbx-votsokgwsa-n
 
* smiles:
 
** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7647]]
+
* [[ALKYLGLYCERONE-PHOSPHATE-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7645]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pinocembrin chalcone}}
+
{{#set: common-name=a 1-long-chain acyl-glycerone 3-phosphate}}
{{#set: molecular-weight=256.257}}
 
{{#set: inchi-key=inchikey=loyxtwzxlwhmbx-votsokgwsa-n}}
 

Revision as of 15:13, 15 March 2021

Metabolite CPD-415

  • common-name:
    • a 1-long-chain acyl-glycerone 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality