Difference between revisions of "CPD-11555"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-phospho-ligated-tRNA == * common_name: ** a 2'-phospho-[ligated trna] == Reaction(s) known to consume the compound == * 2.7.1.160-RXN...") |
(Created page with "Category:metabolite == Metabolite CPD-674 == * common-name: ** trans-cinnamate * molecular-weight: ** 147.153 * inchi-key: ** wbywaxjhaxsjni-votsokgwsa-m * smiles: ** c(=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-674 == |
| − | * | + | * common-name: |
| − | ** | + | ** trans-cinnamate |
| + | * molecular-weight: | ||
| + | ** 147.153 | ||
| + | * inchi-key: | ||
| + | ** wbywaxjhaxsjni-votsokgwsa-m | ||
| + | * smiles: | ||
| + | ** c(=o)([o-])c=cc1(=cc=cc=c1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-2001]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common-name=trans-cinnamate}} |
| + | {{#set: molecular-weight=147.153}} | ||
| + | {{#set: inchi-key=inchikey=wbywaxjhaxsjni-votsokgwsa-m}} | ||
Revision as of 15:13, 15 March 2021
Contents
Metabolite CPD-674
- common-name:
- trans-cinnamate
- molecular-weight:
- 147.153
- inchi-key:
- wbywaxjhaxsjni-votsokgwsa-m
- smiles:
- c(=o)([o-])c=cc1(=cc=cc=c1)
