Difference between revisions of "CPD-85"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Reduced-Flavoproteins == * common-name: ** a [reduced flavoprotein] == Reaction(s) known to consume the compound == * BTUR2-RXN == Re...") |
(Created page with "Category:metabolite == Metabolite GUANOSINE == * common-name: ** guanosine * molecular-weight: ** 283.243 * inchi-key: ** nyhbqmygnkiuif-uuokfmhzsa-n * smiles: ** c(o)c1(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GUANOSINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** guanosine |
| + | * molecular-weight: | ||
| + | ** 283.243 | ||
| + | * inchi-key: | ||
| + | ** nyhbqmygnkiuif-uuokfmhzsa-n | ||
| + | * smiles: | ||
| + | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7609]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=guanosine}} |
| + | {{#set: molecular-weight=283.243}} | ||
| + | {{#set: inchi-key=inchikey=nyhbqmygnkiuif-uuokfmhzsa-n}} | ||
Revision as of 15:13, 15 March 2021
Contents
Metabolite GUANOSINE
- common-name:
- guanosine
- molecular-weight:
- 283.243
- inchi-key:
- nyhbqmygnkiuif-uuokfmhzsa-n
- smiles:
- c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
