Difference between revisions of "L-1-phosphatidyl-inositols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Maltodextrins == * common-name: ** a maltodextrin == Reaction(s) known to consume the compound == * RXN-12171 == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite CPD-9864 == * common-name: ** 3-decaprenyl-4-hydroxybenzoate * molecular-weight: ** 818.297 * inchi-key: ** cmpnjzrebhcphn-ltnibbdrsa-m *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9864 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-decaprenyl-4-hydroxybenzoate |
| + | * molecular-weight: | ||
| + | ** 818.297 | ||
| + | * inchi-key: | ||
| + | ** cmpnjzrebhcphn-ltnibbdrsa-m | ||
| + | * smiles: | ||
| + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c)c)c)c)c)c | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9230]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-decaprenyl-4-hydroxybenzoate}} |
| + | {{#set: molecular-weight=818.297}} | ||
| + | {{#set: inchi-key=inchikey=cmpnjzrebhcphn-ltnibbdrsa-m}} | ||
Revision as of 15:13, 15 March 2021
Contents
Metabolite CPD-9864
- common-name:
- 3-decaprenyl-4-hydroxybenzoate
- molecular-weight:
- 818.297
- inchi-key:
- cmpnjzrebhcphn-ltnibbdrsa-m
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c)c)c)c)c)c
