Difference between revisions of "CPD-9459"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-AMINO-4-DEOXYCHORISMATE == * common-name: ** 4-amino-4-deoxychorismate * molecular-weight: ** 224.193 * inchi-key: ** oiujhgolfkdbsu-ht...") |
(Created page with "Category:metabolite == Metabolite CPD-787 == * common-name: ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate * molecular-weight: ** 170.121 * inchi-key: ** zbcbetmbsdtinl-nwjcxac...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-787 == |
* common-name: | * common-name: | ||
− | ** | + | ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 170.121 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** zbcbetmbsdtinl-nwjcxacmsa-l |
* smiles: | * smiles: | ||
− | ** | + | ** c([o-])(=o)cc=cc=c(o)c(=o)[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN1K-87]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2z,4z)-2-hydroxyhepta-2,4-dienedioate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=170.121}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zbcbetmbsdtinl-nwjcxacmsa-l}} |
Revision as of 15:13, 15 March 2021
Contents
Metabolite CPD-787
- common-name:
- (2z,4z)-2-hydroxyhepta-2,4-dienedioate
- molecular-weight:
- 170.121
- inchi-key:
- zbcbetmbsdtinl-nwjcxacmsa-l
- smiles:
- c([o-])(=o)cc=cc=c(o)c(=o)[o-]