Difference between revisions of "MAPKK-L-serine-or-L-threonine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite trans-20-CP-22-Me-39-keto-40-Me-C61-ACPs == * common-name: ** a trans-keto-c61-meroacyl-[acp] == Reaction(s) known to consume the compoun...")
(Created page with "Category:metabolite == Metabolite PYRIDOXAMINE-5P == * common-name: ** pyridoxamine 5'-phosphate * molecular-weight: ** 247.167 * inchi-key: ** zmjgsosnspkhnh-uhfffaoysa-m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite trans-20-CP-22-Me-39-keto-40-Me-C61-ACPs ==
+
== Metabolite PYRIDOXAMINE-5P ==
 
* common-name:
 
* common-name:
** a trans-keto-c61-meroacyl-[acp]
+
** pyridoxamine 5'-phosphate
 +
* molecular-weight:
 +
** 247.167
 +
* inchi-key:
 +
** zmjgsosnspkhnh-uhfffaoysa-m
 +
* smiles:
 +
** cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PMPOXI-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1G-3667]]
+
* [[PYRAMKIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trans-keto-c61-meroacyl-[acp]}}
+
{{#set: common-name=pyridoxamine 5'-phosphate}}
 +
{{#set: molecular-weight=247.167}}
 +
{{#set: inchi-key=inchikey=zmjgsosnspkhnh-uhfffaoysa-m}}

Revision as of 15:13, 15 March 2021

Metabolite PYRIDOXAMINE-5P

  • common-name:
    • pyridoxamine 5'-phosphate
  • molecular-weight:
    • 247.167
  • inchi-key:
    • zmjgsosnspkhnh-uhfffaoysa-m
  • smiles:
    • cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality